methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate

C18H21NO2 — CID 60690722

IUPACmethyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate
SMILESCOC(=O)c1ccc(C)c(NCc2cc(C)cc(C)c2)c1
InChIInChI=1S/C18H21NO2/c1-12-7-13(2)9-15(8-12)11-19-17-10-16(18(20)21-4)6-5-14(17)3/h5-10,19H,11H2,1-4H3
InChIKeyZJMGJJOZQYHXGR-UHFFFAOYSA-N
MW283.37 g/mol
LogP4.01
Rot. Bonds4

About methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate

methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate (PubChem CID 60690722) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate.

Molecular Properties

Compound Namemethyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate
PubChem CID60690722
Molecular FormulaC18H21NO2
Molecular Weight283.37 g/mol
Exact Mass283.16
IUPAC Namemethyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate
SMILESCOC(=O)c1ccc(C)c(NCc2cc(C)cc(C)c2)c1
InChIInChI=1S/C18H21NO2/c1-12-7-13(2)9-15(8-12)11-19-17-10-16(18(20)21-4)6-5-14(17)3/h5-10,19H,11H2,1-4H3
InChIKeyZJMGJJOZQYHXGR-UHFFFAOYSA-N
XLogP4.01
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.37
LogP ≤ 54.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate?
The IUPAC name of methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate (CID 60690722) is methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate.
What is the SMILES notation for methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate?
The canonical SMILES for methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate is COC(=O)c1ccc(C)c(NCc2cc(C)cc(C)c2)c1.
What is the InChIKey of methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate?
The InChIKey is ZJMGJJOZQYHXGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-12-7-13(2)9-15(8-12)11-19-17-10-16(18(20)21-4)6-5-14(17)3/h5-10,19H,11H2,1-4H3.
What are the key properties of methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate?
methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate has a molecular weight of 283.37 g/mol, XLogP of 4.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3,5-dimethylphenyl)methylamino]-4-methylbenzoate is sourced from PubChem (CID 60690722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).