C10H8N4SSe — CID 60690748
N-(1,3-thiazol-4-ylmethyl)-2,1,3-benzoselenadiazol-4-amine (PubChem CID 60690748) has the molecular formula C10H8N4SSe and a molecular weight of 295.23 g/mol. Its IUPAC name is N-(1,3-thiazol-4-ylmethyl)-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-(1,3-thiazol-4-ylmethyl)-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 60690748 |
| Molecular Formula | C10H8N4SSe |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | N-(1,3-thiazol-4-ylmethyl)-2,1,3-benzoselenadiazol-4-amine |
| SMILES | c1cc(NCc2cscn2)c2n[se]nc2c1 |
| InChI | InChI=1S/C10H8N4SSe/c1-2-8(10-9(3-1)13-16-14-10)11-4-7-5-15-6-12-7/h1-3,5-6,11H,4H2 |
| InChIKey | MWJMECVFHWTSMM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|