C11H24N2O2 — CID 60691813
N-butan-2-yl-2-[2-hydroxyethyl(propyl)amino]acetamide (PubChem CID 60691813) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is N-butan-2-yl-2-[2-hydroxyethyl(propyl)amino]acetamide.
| Compound Name | N-butan-2-yl-2-[2-hydroxyethyl(propyl)amino]acetamide |
|---|---|
| PubChem CID | 60691813 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N-butan-2-yl-2-[2-hydroxyethyl(propyl)amino]acetamide |
| SMILES | CCCN(CCO)CC(=O)NC(C)CC |
| InChI | InChI=1S/C11H24N2O2/c1-4-6-13(7-8-14)9-11(15)12-10(3)5-2/h10,14H,4-9H2,1-3H3,(H,12,15) |
| InChIKey | FKXLBNNGHRMNJB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |