About 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide
2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide (PubChem CID 60693637) has the molecular formula C8H11N3O3S
and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide.
Molecular Properties
| Compound Name | 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide |
| PubChem CID | 60693637 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide |
| SMILES | Cc1csc(=O)n1CC(=O)NCC(N)=O |
| InChI | InChI=1S/C8H11N3O3S/c1-5-4-15-8(14)11(5)3-7(13)10-2-6(9)12/h4H,2-3H2,1H3,(H2,9,12)(H,10,13) |
| InChIKey | GJHZIYAMEHKJMJ-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide?
The IUPAC name of 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide (CID 60693637) is 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide.
What is the SMILES notation for 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide?
The canonical SMILES for 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide is Cc1csc(=O)n1CC(=O)NCC(N)=O.
What is the InChIKey of 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide?
The InChIKey is GJHZIYAMEHKJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3S/c1-5-4-15-8(14)11(5)3-7(13)10-2-6(9)12/h4H,2-3H2,1H3,(H2,9,12)(H,10,13).
What are the key properties of 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide?
2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide has a molecular weight of 229.26 g/mol, XLogP of -1.18, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]amino]acetamide is sourced from PubChem (CID 60693637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).