C14H20FN3O2 — CID 60695769
2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]-N-propylpropanamide (PubChem CID 60695769) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]-N-propylpropanamide.
| Compound Name | 2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 60695769 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-[[2-(2-fluoroanilino)-2-oxoethyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NCC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C14H20FN3O2/c1-3-8-16-14(20)10(2)17-9-13(19)18-12-7-5-4-6-11(12)15/h4-7,10,17H,3,8-9H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | JIHVONPRXPEMPJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |