C14H18ClN3O — CID 60696457
2-[(2-chlorophenyl)methyl-methylamino]-N-(2-cyanoethyl)-N-methylacetamide (PubChem CID 60696457) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylamino]-N-(2-cyanoethyl)-N-methylacetamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(2-cyanoethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 60696457 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylamino]-N-(2-cyanoethyl)-N-methylacetamide |
| SMILES | CN(CC(=O)N(C)CCC#N)Cc1ccccc1Cl |
| InChI | InChI=1S/C14H18ClN3O/c1-17(10-12-6-3-4-7-13(12)15)11-14(19)18(2)9-5-8-16/h3-4,6-7H,5,9-11H2,1-2H3 |
| InChIKey | GZTJAMVRHGXIKP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |