C10H12N2S2 — CID 60696751
N-(1,3-thiazol-4-ylmethyl)-1-thiophen-2-ylethanamine (PubChem CID 60696751) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is N-(1,3-thiazol-4-ylmethyl)-1-thiophen-2-ylethanamine.
| Compound Name | N-(1,3-thiazol-4-ylmethyl)-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 60696751 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | N-(1,3-thiazol-4-ylmethyl)-1-thiophen-2-ylethanamine |
| SMILES | CC(NCc1cscn1)c1cccs1 |
| InChI | InChI=1S/C10H12N2S2/c1-8(10-3-2-4-14-10)11-5-9-6-13-7-12-9/h2-4,6-8,11H,5H2,1H3 |
| InChIKey | VXLVPFVNDSVMBK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |