About 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine
3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine (PubChem CID 60696926) has the molecular formula C13H22N2OS
and a molecular weight of 254.40 g/mol. Its IUPAC name is 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
| PubChem CID | 60696926 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
| SMILES | c1nc(CNCCCOC2CCCCC2)cs1 |
| InChI | InChI=1S/C13H22N2OS/c1-2-5-13(6-3-1)16-8-4-7-14-9-12-10-17-11-15-12/h10-11,13-14H,1-9H2 |
| InChIKey | OBLNYSXRLSKMRP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine?
The IUPAC name of 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine (CID 60696926) is 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine.
What is the SMILES notation for 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine?
The canonical SMILES for 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine is c1nc(CNCCCOC2CCCCC2)cs1.
What is the InChIKey of 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine?
The InChIKey is OBLNYSXRLSKMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2OS/c1-2-5-13(6-3-1)16-8-4-7-14-9-12-10-17-11-15-12/h10-11,13-14H,1-9H2.
What are the key properties of 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine?
3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine has a molecular weight of 254.40 g/mol, XLogP of 2.97, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyloxy-N-(1,3-thiazol-4-ylmethyl)propan-1-amine is sourced from PubChem (CID 60696926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).