C13H16ClN3 — CID 60699444
N-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]methyl]ethanamine (PubChem CID 60699444) has the molecular formula C13H16ClN3 and a molecular weight of 249.75 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 60699444 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]pyrazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cnn(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C13H16ClN3/c1-2-15-7-11-8-16-17(9-11)10-12-5-3-4-6-13(12)14/h3-6,8-9,15H,2,7,10H2,1H3 |
| InChIKey | QBARUYXNWWIIND-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |