About 9,9-dimethylxanthene
9,9-dimethylxanthene (PubChem CID 606997) has the molecular formula C15H14O
and a molecular weight of 210.28 g/mol. Its IUPAC name is 9,9-dimethylxanthene.
Molecular Properties
| Compound Name | 9,9-dimethylxanthene |
| PubChem CID | 606997 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 9,9-dimethylxanthene |
| SMILES | CC1(C)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C15H14O/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h3-10H,1-2H3 |
| InChIKey | MTVNAPYHLASOSX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9,9-dimethylxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethylxanthene?
The IUPAC name of 9,9-dimethylxanthene (CID 606997) is 9,9-dimethylxanthene.
What is the SMILES notation for 9,9-dimethylxanthene?
The canonical SMILES for 9,9-dimethylxanthene is CC1(C)c2ccccc2Oc2ccccc21.
What is the InChIKey of 9,9-dimethylxanthene?
The InChIKey is MTVNAPYHLASOSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h3-10H,1-2H3.
What are the key properties of 9,9-dimethylxanthene?
9,9-dimethylxanthene has a molecular weight of 210.28 g/mol, XLogP of 4.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethylxanthene is sourced from PubChem (CID 606997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).