C11H20N2O3 — CID 60699890
methyl 3-(4-acetyl-1,4-diazepan-1-yl)propanoate (PubChem CID 60699890) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 3-(4-acetyl-1,4-diazepan-1-yl)propanoate.
| Compound Name | methyl 3-(4-acetyl-1,4-diazepan-1-yl)propanoate |
|---|---|
| PubChem CID | 60699890 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | methyl 3-(4-acetyl-1,4-diazepan-1-yl)propanoate |
| SMILES | COC(=O)CCN1CCCN(C(C)=O)CC1 |
| InChI | InChI=1S/C11H20N2O3/c1-10(14)13-6-3-5-12(8-9-13)7-4-11(15)16-2/h3-9H2,1-2H3 |
| InChIKey | AZMFRCKVTKYNTC-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |