C13H19NO2S — CID 60700456
N-ethoxy-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 60700456) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N-ethoxy-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-ethoxy-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 60700456 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-ethoxy-5-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CCONC(=O)c1cc2c(s1)CCC(CC)C2 |
| InChI | InChI=1S/C13H19NO2S/c1-3-9-5-6-11-10(7-9)8-12(17-11)13(15)14-16-4-2/h8-9H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | QTDBFGFBOPEVFI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|