About N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide
N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 60700460) has the molecular formula C8H13N3O4
and a molecular weight of 215.21 g/mol. Its IUPAC name is N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| PubChem CID | 60700460 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCONC(=O)CN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C8H13N3O4/c1-3-15-9-6(12)4-11-7(13)5-10(2)8(11)14/h3-5H2,1-2H3,(H,9,12) |
| InChIKey | FFFDUHUPCBCPKK-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide?
The IUPAC name of N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (CID 60700460) is N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
What is the SMILES notation for N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide?
The canonical SMILES for N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide is CCONC(=O)CN1C(=O)CN(C)C1=O.
What is the InChIKey of N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide?
The InChIKey is FFFDUHUPCBCPKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O4/c1-3-15-9-6(12)4-11-7(13)5-10(2)8(11)14/h3-5H2,1-2H3,(H,9,12).
What are the key properties of N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide?
N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide has a molecular weight of 215.21 g/mol, XLogP of -1.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide is sourced from PubChem (CID 60700460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).