C12H17NO2 — CID 60701058
2-(3-methoxy-4-methylphenyl)-N,N-dimethylacetamide (PubChem CID 60701058) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(3-methoxy-4-methylphenyl)-N,N-dimethylacetamide.
| Compound Name | 2-(3-methoxy-4-methylphenyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 60701058 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-(3-methoxy-4-methylphenyl)-N,N-dimethylacetamide |
| SMILES | COc1cc(CC(=O)N(C)C)ccc1C |
| InChI | InChI=1S/C12H17NO2/c1-9-5-6-10(7-11(9)15-4)8-12(14)13(2)3/h5-7H,8H2,1-4H3 |
| InChIKey | URHJJYXIXHOTSX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |