C13H14F3NO3 — CID 60701199
2-(2-acetyl-5-methylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 60701199) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-(2-acetyl-5-methylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2-acetyl-5-methylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 60701199 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-(2-acetyl-5-methylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC(=O)c1ccc(C)cc1OCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C13H14F3NO3/c1-8-3-4-10(9(2)18)11(5-8)20-6-12(19)17-7-13(14,15)16/h3-5H,6-7H2,1-2H3,(H,17,19) |
| InChIKey | XMOVIONVABVJPU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |