About 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol
2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol (PubChem CID 60701626) has the molecular formula C10H13N3O2S
and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol |
| PubChem CID | 60701626 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol |
| SMILES | OCCOCCNc1ncnc2ccsc12 |
| InChI | InChI=1S/C10H13N3O2S/c14-3-5-15-4-2-11-10-9-8(1-6-16-9)12-7-13-10/h1,6-7,14H,2-5H2,(H,11,12,13) |
| InChIKey | RFUBZKLIAQNWJN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol?
The IUPAC name of 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol (CID 60701626) is 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol.
What is the SMILES notation for 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol?
The canonical SMILES for 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol is OCCOCCNc1ncnc2ccsc12.
What is the InChIKey of 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol?
The InChIKey is RFUBZKLIAQNWJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2S/c14-3-5-15-4-2-11-10-9-8(1-6-16-9)12-7-13-10/h1,6-7,14H,2-5H2,(H,11,12,13).
What are the key properties of 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol?
2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol has a molecular weight of 239.30 g/mol, XLogP of 1.11, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethoxy]ethanol is sourced from PubChem (CID 60701626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).