C15H19N3 — CID 60703972
3,6-dimethyl-N-[1-(2-methylphenyl)ethyl]pyrazin-2-amine (PubChem CID 60703972) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 3,6-dimethyl-N-[1-(2-methylphenyl)ethyl]pyrazin-2-amine.
| Compound Name | 3,6-dimethyl-N-[1-(2-methylphenyl)ethyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 60703972 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 3,6-dimethyl-N-[1-(2-methylphenyl)ethyl]pyrazin-2-amine |
| SMILES | Cc1cnc(C)c(NC(C)c2ccccc2C)n1 |
| InChI | InChI=1S/C15H19N3/c1-10-7-5-6-8-14(10)12(3)18-15-13(4)16-9-11(2)17-15/h5-9,12H,1-4H3,(H,17,18) |
| InChIKey | NDRDRVWKXOAZSC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |