C15H24N4O — CID 60703987
N,N-dimethyl-4-(3-pyrrolidin-1-ylpropylamino)pyridine-2-carboxamide (PubChem CID 60703987) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-pyrrolidin-1-ylpropylamino)pyridine-2-carboxamide.
| Compound Name | N,N-dimethyl-4-(3-pyrrolidin-1-ylpropylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 60703987 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N,N-dimethyl-4-(3-pyrrolidin-1-ylpropylamino)pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc(NCCCN2CCCC2)ccn1 |
| InChI | InChI=1S/C15H24N4O/c1-18(2)15(20)14-12-13(6-8-17-14)16-7-5-11-19-9-3-4-10-19/h6,8,12H,3-5,7,9-11H2,1-2H3,(H,16,17) |
| InChIKey | FXXPVIQOOADRMQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|