C8H6F4O2 — CID 607045
1,2,4,5-tetrafluoro-3,6-dimethoxybenzene (PubChem CID 607045) has the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-dimethoxybenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-dimethoxybenzene |
|---|---|
| PubChem CID | 607045 |
| Molecular Formula | C8H6F4O2 |
| Molecular Weight | 210.13 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-dimethoxybenzene |
| SMILES | COc1c(F)c(F)c(OC)c(F)c1F |
| InChI | InChI=1S/C8H6F4O2/c1-13-7-3(9)5(11)8(14-2)6(12)4(7)10/h1-2H3 |
| InChIKey | WQXKGOOORHDGFP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.13 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|