C16H16N2O2 — CID 60704811
5-(8-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-1H-pyridin-2-one (PubChem CID 60704811) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-(8-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-1H-pyridin-2-one.
| Compound Name | 5-(8-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 60704811 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-(8-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-1H-pyridin-2-one |
| SMILES | Cc1cccc2c1N(C(=O)c1ccc(=O)[nH]c1)CCC2 |
| InChI | InChI=1S/C16H16N2O2/c1-11-4-2-5-12-6-3-9-18(15(11)12)16(20)13-7-8-14(19)17-10-13/h2,4-5,7-8,10H,3,6,9H2,1H3,(H,17,19) |
| InChIKey | OGUBORSAIQOTFG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |