C11H13NO2S2 — CID 60705280
N-(1-benzothiophen-5-yl)propane-1-sulfonamide (PubChem CID 60705280) has the molecular formula C11H13NO2S2 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-(1-benzothiophen-5-yl)propane-1-sulfonamide.
| Compound Name | N-(1-benzothiophen-5-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60705280 |
| Molecular Formula | C11H13NO2S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | N-(1-benzothiophen-5-yl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc2sccc2c1 |
| InChI | InChI=1S/C11H13NO2S2/c1-2-7-16(13,14)12-10-3-4-11-9(8-10)5-6-15-11/h3-6,8,12H,2,7H2,1H3 |
| InChIKey | YNKQLBYRZBSJNW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |