C8H12N4O2S2 — CID 60705290
2-(1,1-dioxothiolan-3-yl)sulfanylpyrimidine-4,6-diamine (PubChem CID 60705290) has the molecular formula C8H12N4O2S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)sulfanylpyrimidine-4,6-diamine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)sulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 60705290 |
| Molecular Formula | C8H12N4O2S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)sulfanylpyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(SC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C8H12N4O2S2/c9-6-3-7(10)12-8(11-6)15-5-1-2-16(13,14)4-5/h3,5H,1-2,4H2,(H4,9,10,11,12) |
| InChIKey | HAXCGUGWHCNDLB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |