C9H15F3N2O2 — CID 60705337
ethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate (PubChem CID 60705337) has the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is ethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 60705337 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | ethyl 4-(2,2,2-trifluoroethyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H15F3N2O2/c1-2-16-8(15)14-5-3-13(4-6-14)7-9(10,11)12/h2-7H2,1H3 |
| InChIKey | GBTAIYZVLACJSE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |