C23H24N2O2S — CID 6070636
(8E)-4-(4-methoxyphenyl)-8-[(4-methoxyphenyl)methylidene]-3,4,4a,5,6,7-hexahydroquinazoline-2-thione (PubChem CID 6070636) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is (8E)-4-(4-methoxyphenyl)-8-[(4-methoxyphenyl)methylidene]-3,4,4a,5,6,7-hexahydroquinazoline-2-thione.
| Compound Name | (8E)-4-(4-methoxyphenyl)-8-[(4-methoxyphenyl)methylidene]-3,4,4a,5,6,7-hexahydroquinazoline-2-thione |
|---|---|
| PubChem CID | 6070636 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (8E)-4-(4-methoxyphenyl)-8-[(4-methoxyphenyl)methylidene]-3,4,4a,5,6,7-hexahydroquinazoline-2-thione |
| SMILES | COc1ccc(/C=C2\CCCC3C2=NC(=S)NC3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O2S/c1-26-18-10-6-15(7-11-18)14-17-4-3-5-20-21(24-23(28)25-22(17)20)16-8-12-19(27-2)13-9-16/h6-14,20-21H,3-5H2,1-2H3,(H,24,28)/b17-14+ |
| InChIKey | GOZPBMCCEGQPIM-SAPNQHFASA-N |
| XLogP | 4.96 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|