C18H18N2S — CID 60707088
2-[4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-yl]aniline (PubChem CID 60707088) has the molecular formula C18H18N2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-yl]aniline.
| Compound Name | 2-[4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-yl]aniline |
|---|---|
| PubChem CID | 60707088 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-yl]aniline |
| SMILES | CCc1ccc(-c2nc(-c3ccccc3N)sc2C)cc1 |
| InChI | InChI=1S/C18H18N2S/c1-3-13-8-10-14(11-9-13)17-12(2)21-18(20-17)15-6-4-5-7-16(15)19/h4-11H,3,19H2,1-2H3 |
| InChIKey | OZQZVSQFAVSLDM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|