C11H10F5NO — CID 607087
N-butan-2-yl-2,3,4,5,6-pentafluorobenzamide (PubChem CID 607087) has the molecular formula C11H10F5NO and a molecular weight of 267.20 g/mol. Its IUPAC name is N-butan-2-yl-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-butan-2-yl-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 607087 |
| Molecular Formula | C11H10F5NO |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-butan-2-yl-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CCC(C)NC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H10F5NO/c1-3-4(2)17-11(18)5-6(12)8(14)10(16)9(15)7(5)13/h4H,3H2,1-2H3,(H,17,18) |
| InChIKey | LLYDXLJCSZXBPV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|