C20H18ClF5N2O2 — CID 607089
N-butyl-N-[2-(2-chloro-6-methylanilino)-2-oxoethyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 607089) has the molecular formula C20H18ClF5N2O2 and a molecular weight of 448.82 g/mol. Its IUPAC name is N-butyl-N-[2-(2-chloro-6-methylanilino)-2-oxoethyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-butyl-N-[2-(2-chloro-6-methylanilino)-2-oxoethyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 607089 |
| Molecular Formula | C20H18ClF5N2O2 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-butyl-N-[2-(2-chloro-6-methylanilino)-2-oxoethyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CCCCN(CC(=O)Nc1c(C)cccc1Cl)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H18ClF5N2O2/c1-3-4-8-28(9-12(29)27-19-10(2)6-5-7-11(19)21)20(30)13-14(22)16(24)18(26)17(25)15(13)23/h5-7H,3-4,8-9H2,1-2H3,(H,27,29) |
| InChIKey | YATDIVHBOZQSAW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|