About 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one
1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one (PubChem CID 60709201) has the molecular formula C11H16N2O3S2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one |
| PubChem CID | 60709201 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one |
| SMILES | Cc1cc(S(=O)(=O)N2CCNC(=O)CC2)c(C)s1 |
| InChI | InChI=1S/C11H16N2O3S2/c1-8-7-10(9(2)17-8)18(15,16)13-5-3-11(14)12-4-6-13/h7H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | BHHDAQBCSDHNMD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one?
The IUPAC name of 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one (CID 60709201) is 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one.
What is the SMILES notation for 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one?
The canonical SMILES for 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one is Cc1cc(S(=O)(=O)N2CCNC(=O)CC2)c(C)s1.
What is the InChIKey of 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one?
The InChIKey is BHHDAQBCSDHNMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3S2/c1-8-7-10(9(2)17-8)18(15,16)13-5-3-11(14)12-4-6-13/h7H,3-6H2,1-2H3,(H,12,14).
What are the key properties of 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one?
1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one has a molecular weight of 288.39 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethylthiophen-3-yl)sulfonyl-1,4-diazepan-5-one is sourced from PubChem (CID 60709201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).