C15H15ClFNO2S — CID 60709307
N-[1-(4-chlorophenyl)propyl]-2-fluorobenzenesulfonamide (PubChem CID 60709307) has the molecular formula C15H15ClFNO2S and a molecular weight of 327.81 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)propyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[1-(4-chlorophenyl)propyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 60709307 |
| Molecular Formula | C15H15ClFNO2S |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-[1-(4-chlorophenyl)propyl]-2-fluorobenzenesulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccccc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClFNO2S/c1-2-14(11-7-9-12(16)10-8-11)18-21(19,20)15-6-4-3-5-13(15)17/h3-10,14,18H,2H2,1H3 |
| InChIKey | NFMHXGSPBNMXPJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |