C12H12N2O2S — CID 60709490
4-hydroxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide (PubChem CID 60709490) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 4-hydroxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide.
| Compound Name | 4-hydroxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 60709490 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4-hydroxy-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide |
| SMILES | Cc1csc(CNC(=O)c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C12H12N2O2S/c1-8-7-17-11(14-8)6-13-12(16)9-2-4-10(15)5-3-9/h2-5,7,15H,6H2,1H3,(H,13,16) |
| InChIKey | QQOBHUGRCXCZCF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |