About 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine
2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine (PubChem CID 60709847) has the molecular formula C11H26N2O2S
and a molecular weight of 250.41 g/mol. Its IUPAC name is 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine |
| PubChem CID | 60709847 |
| Molecular Formula | C11H26N2O2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine |
| SMILES | COCCN(CCOC)C(CN)CCSC |
| InChI | InChI=1S/C11H26N2O2S/c1-14-7-5-13(6-8-15-2)11(10-12)4-9-16-3/h11H,4-10,12H2,1-3H3 |
| InChIKey | QKYLYZKQAJXWFM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine?
The IUPAC name of 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine (CID 60709847) is 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine.
What is the SMILES notation for 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine?
The canonical SMILES for 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine is COCCN(CCOC)C(CN)CCSC.
What is the InChIKey of 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine?
The InChIKey is QKYLYZKQAJXWFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2O2S/c1-14-7-5-13(6-8-15-2)11(10-12)4-9-16-3/h11H,4-10,12H2,1-3H3.
What are the key properties of 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine?
2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine has a molecular weight of 250.41 g/mol, XLogP of 0.66, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-bis(2-methoxyethyl)-4-methylsulfanylbutane-1,2-diamine is sourced from PubChem (CID 60709847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).