About 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile
1-prop-2-enyl-1,2,4-triazole-3-carbonitrile (PubChem CID 60710153) has the molecular formula C6H6N4
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile.
Molecular Properties
| Compound Name | 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile |
| PubChem CID | 60710153 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile |
| SMILES | C=CCn1cnc(C#N)n1 |
| InChI | InChI=1S/C6H6N4/c1-2-3-10-5-8-6(4-7)9-10/h2,5H,1,3H2 |
| InChIKey | CBBFWPNYAFQGOQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile (CID 60710153) is 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile is C=CCn1cnc(C#N)n1.
What is the InChIKey of 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile?
The InChIKey is CBBFWPNYAFQGOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4/c1-2-3-10-5-8-6(4-7)9-10/h2,5H,1,3H2.
What are the key properties of 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile?
1-prop-2-enyl-1,2,4-triazole-3-carbonitrile has a molecular weight of 134.14 g/mol, XLogP of 0.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 60710153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).