About 1-methyl-1,2,4-triazole-3-carbonitrile
1-methyl-1,2,4-triazole-3-carbonitrile (PubChem CID 60710317) has the molecular formula C4H4N4
and a molecular weight of 108.10 g/mol. Its IUPAC name is 1-methyl-1,2,4-triazole-3-carbonitrile.
Molecular Properties
| Compound Name | 1-methyl-1,2,4-triazole-3-carbonitrile |
| PubChem CID | 60710317 |
| Molecular Formula | C4H4N4 |
| Molecular Weight | 108.10 g/mol |
| Exact Mass | 108.04 |
| IUPAC Name | 1-methyl-1,2,4-triazole-3-carbonitrile |
| SMILES | Cn1cnc(C#N)n1 |
| InChI | InChI=1S/C4H4N4/c1-8-3-6-4(2-5)7-8/h3H,1H3 |
| InChIKey | FLGDSZZTEJTGJH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.10 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 1-methyl-1,2,4-triazole-3-carbonitrile (CID 60710317) is 1-methyl-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 1-methyl-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 1-methyl-1,2,4-triazole-3-carbonitrile is Cn1cnc(C#N)n1.
What is the InChIKey of 1-methyl-1,2,4-triazole-3-carbonitrile?
The InChIKey is FLGDSZZTEJTGJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N4/c1-8-3-6-4(2-5)7-8/h3H,1H3.
What are the key properties of 1-methyl-1,2,4-triazole-3-carbonitrile?
1-methyl-1,2,4-triazole-3-carbonitrile has a molecular weight of 108.10 g/mol, XLogP of -0.31, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 60710317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).