About 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol
1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol (PubChem CID 60710621) has the molecular formula C18H33NO
and a molecular weight of 279.47 g/mol. Its IUPAC name is 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol.
Molecular Properties
| Compound Name | 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol |
| PubChem CID | 60710621 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol |
| SMILES | CC1(C)C2CCC1(C)C(NCC1(O)CCCCCC1)C2 |
| InChI | InChI=1S/C18H33NO/c1-16(2)14-8-11-17(16,3)15(12-14)19-13-18(20)9-6-4-5-7-10-18/h14-15,19-20H,4-13H2,1-3H3 |
| InChIKey | BJWNKMWZBLKIAX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol?
The IUPAC name of 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol (CID 60710621) is 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol.
What is the SMILES notation for 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol?
The canonical SMILES for 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol is CC1(C)C2CCC1(C)C(NCC1(O)CCCCCC1)C2.
What is the InChIKey of 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol?
The InChIKey is BJWNKMWZBLKIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO/c1-16(2)14-8-11-17(16,3)15(12-14)19-13-18(20)9-6-4-5-7-10-18/h14-15,19-20H,4-13H2,1-3H3.
What are the key properties of 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol?
1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol has a molecular weight of 279.47 g/mol, XLogP of 3.88, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]methyl]cycloheptan-1-ol is sourced from PubChem (CID 60710621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).