C17H21NO2S — CID 60711317
N-[(2,5-dimethylphenyl)methyl]-4-ethylsulfonylaniline (PubChem CID 60711317) has the molecular formula C17H21NO2S and a molecular weight of 303.43 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)methyl]-4-ethylsulfonylaniline.
| Compound Name | N-[(2,5-dimethylphenyl)methyl]-4-ethylsulfonylaniline |
|---|---|
| PubChem CID | 60711317 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[(2,5-dimethylphenyl)methyl]-4-ethylsulfonylaniline |
| SMILES | CCS(=O)(=O)c1ccc(NCc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C17H21NO2S/c1-4-21(19,20)17-9-7-16(8-10-17)18-12-15-11-13(2)5-6-14(15)3/h5-11,18H,4,12H2,1-3H3 |
| InChIKey | FYZQZHRTOPGUHD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |