About 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione
7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione (PubChem CID 60711509) has the molecular formula C17H14BrNO2
and a molecular weight of 344.21 g/mol. Its IUPAC name is 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione.
Molecular Properties
| Compound Name | 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione |
| PubChem CID | 60711509 |
| Molecular Formula | C17H14BrNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione |
| SMILES | Cc1cc(C)cc(CN2C(=O)C(=O)c3cccc(Br)c32)c1 |
| InChI | InChI=1S/C17H14BrNO2/c1-10-6-11(2)8-12(7-10)9-19-15-13(16(20)17(19)21)4-3-5-14(15)18/h3-8H,9H2,1-2H3 |
| InChIKey | CJROVGWYOVLVIF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione?
The IUPAC name of 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione (CID 60711509) is 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione.
What is the SMILES notation for 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione?
The canonical SMILES for 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione is Cc1cc(C)cc(CN2C(=O)C(=O)c3cccc(Br)c32)c1.
What is the InChIKey of 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione?
The InChIKey is CJROVGWYOVLVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrNO2/c1-10-6-11(2)8-12(7-10)9-19-15-13(16(20)17(19)21)4-3-5-14(15)18/h3-8H,9H2,1-2H3.
What are the key properties of 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione?
7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione has a molecular weight of 344.21 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-[(3,5-dimethylphenyl)methyl]indole-2,3-dione is sourced from PubChem (CID 60711509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).