C10H18N2O3 — CID 60712313
1-(4-acetyl-1,4-diazepan-1-yl)-2-methoxyethanone (PubChem CID 60712313) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-(4-acetyl-1,4-diazepan-1-yl)-2-methoxyethanone.
| Compound Name | 1-(4-acetyl-1,4-diazepan-1-yl)-2-methoxyethanone |
|---|---|
| PubChem CID | 60712313 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-(4-acetyl-1,4-diazepan-1-yl)-2-methoxyethanone |
| SMILES | COCC(=O)N1CCCN(C(C)=O)CC1 |
| InChI | InChI=1S/C10H18N2O3/c1-9(13)11-4-3-5-12(7-6-11)10(14)8-15-2/h3-8H2,1-2H3 |
| InChIKey | ZGOAWXJWCLBXMH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |