C12H15N5O4 — CID 60712418
8-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 60712418) has the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. Its IUPAC name is 8-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 60712418 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 8-(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1CCC(C(=O)N2CCC3(CC2)NC(=O)NC3=O)=NN1 |
| InChI | InChI=1S/C12H15N5O4/c18-8-2-1-7(15-16-8)9(19)17-5-3-12(4-6-17)10(20)13-11(21)14-12/h1-6H2,(H,16,18)(H2,13,14,20,21) |
| InChIKey | TVQQWGFPLQOFBQ-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|