C15H11N3O7 — CID 607127
2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid (PubChem CID 607127) has the molecular formula C15H11N3O7 and a molecular weight of 345.27 g/mol. Its IUPAC name is 2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid.
| Compound Name | 2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 607127 |
| Molecular Formula | C15H11N3O7 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 2-[(3,5-dinitrobenzoyl)amino]-2-phenylacetic acid |
| SMILES | O=C(NC(C(=O)O)c1ccccc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11N3O7/c19-14(16-13(15(20)21)9-4-2-1-3-5-9)10-6-11(17(22)23)8-12(7-10)18(24)25/h1-8,13H,(H,16,19)(H,20,21) |
| InChIKey | MIVUDAUOXJDARR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|