About 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide
2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide (PubChem CID 60712774) has the molecular formula C12H8Cl2N2O4S
and a molecular weight of 347.18 g/mol. Its IUPAC name is 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide |
| PubChem CID | 60712774 |
| Molecular Formula | C12H8Cl2N2O4S |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc2c(cc1Cl)OCO2)c1cccnc1Cl |
| InChI | InChI=1S/C12H8Cl2N2O4S/c13-7-4-9-10(20-6-19-9)5-8(7)16-21(17,18)11-2-1-3-15-12(11)14/h1-5,16H,6H2 |
| InChIKey | LCGJJNKKHDVPJO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide?
The IUPAC name of 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide (CID 60712774) is 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide.
What is the SMILES notation for 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide?
The canonical SMILES for 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide is O=S(=O)(Nc1cc2c(cc1Cl)OCO2)c1cccnc1Cl.
What is the InChIKey of 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide?
The InChIKey is LCGJJNKKHDVPJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2N2O4S/c13-7-4-9-10(20-6-19-9)5-8(7)16-21(17,18)11-2-1-3-15-12(11)14/h1-5,16H,6H2.
What are the key properties of 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide?
2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide has a molecular weight of 347.18 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)pyridine-3-sulfonamide is sourced from PubChem (CID 60712774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).