C14H18N2O3S2 — CID 60712816
N-(4-tert-butylphenyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 60712816) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(4-tert-butylphenyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 60712816 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H18N2O3S2/c1-9-12(20-13(17)15-9)21(18,19)16-11-7-5-10(6-8-11)14(2,3)4/h5-8,16H,1-4H3,(H,15,17) |
| InChIKey | YCZDQRBJJSBGRS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |