About methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate
methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate (PubChem CID 60714511) has the molecular formula C12H17N3O5
and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate.
Molecular Properties
| Compound Name | methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate |
| PubChem CID | 60714511 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C12H17N3O5/c1-14(7-3-4-12(19)20-2)11(18)8-15-10(17)6-5-9(16)13-15/h5-6H,3-4,7-8H2,1-2H3,(H,13,16) |
| InChIKey | VOCBYTAEZKUCKF-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate?
The IUPAC name of methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate (CID 60714511) is methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate.
What is the SMILES notation for methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate?
The canonical SMILES for methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate is COC(=O)CCCN(C)C(=O)Cn1[nH]c(=O)ccc1=O.
What is the InChIKey of methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate?
The InChIKey is VOCBYTAEZKUCKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O5/c1-14(7-3-4-12(19)20-2)11(18)8-15-10(17)6-5-9(16)13-15/h5-6H,3-4,7-8H2,1-2H3,(H,13,16).
What are the key properties of methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate?
methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate has a molecular weight of 283.28 g/mol, XLogP of -1.05, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-methylamino]butanoate is sourced from PubChem (CID 60714511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).