C11H14N2O2 — CID 60715595
N-[(2-methoxy-4-pyridinyl)methyl]cyclopropanecarboxamide (PubChem CID 60715595) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is N-[(2-methoxy-4-pyridinyl)methyl]cyclopropanecarboxamide.
| Compound Name | N-[(2-methoxy-4-pyridinyl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 60715595 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-[(2-methoxy-4-pyridinyl)methyl]cyclopropanecarboxamide |
| SMILES | COc1cc(CNC(=O)C2CC2)ccn1 |
| InChI | InChI=1S/C11H14N2O2/c1-15-10-6-8(4-5-12-10)7-13-11(14)9-2-3-9/h4-6,9H,2-3,7H2,1H3,(H,13,14) |
| InChIKey | AHIKIBZTSVIBAG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |