About methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate
methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate (PubChem CID 60715874) has the molecular formula C10H13N3O5
and a molecular weight of 255.23 g/mol. Its IUPAC name is methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate |
| PubChem CID | 60715874 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H13N3O5/c1-5(9(16)18-2)11-7(14)3-6-4-8(15)13-10(17)12-6/h4-5H,3H2,1-2H3,(H,11,14)(H2,12,13,15,17) |
| InChIKey | YJUZGZZICVFVRL-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate?
The IUPAC name of methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate (CID 60715874) is methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate.
What is the SMILES notation for methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate?
The canonical SMILES for methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate is COC(=O)C(C)NC(=O)Cc1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate?
The InChIKey is YJUZGZZICVFVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O5/c1-5(9(16)18-2)11-7(14)3-6-4-8(15)13-10(17)12-6/h4-5H,3H2,1-2H3,(H,11,14)(H2,12,13,15,17).
What are the key properties of methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate?
methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate has a molecular weight of 255.23 g/mol, XLogP of -1.72, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]propanoate is sourced from PubChem (CID 60715874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).