About N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide
N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 60716086) has the molecular formula C12H13FN2O3S2
and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| PubChem CID | 60716086 |
| Molecular Formula | C12H13FN2O3S2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2O3S2/c1-8-11(19-12(16)14-8)20(17,18)15(2)7-9-3-5-10(13)6-4-9/h3-6H,7H2,1-2H3,(H,14,16) |
| InChIKey | XZLHYAWPQLQVEX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (CID 60716086) is N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide is Cc1[nH]c(=O)sc1S(=O)(=O)N(C)Cc1ccc(F)cc1.
What is the InChIKey of N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The InChIKey is XZLHYAWPQLQVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O3S2/c1-8-11(19-12(16)14-8)20(17,18)15(2)7-9-3-5-10(13)6-4-9/h3-6H,7H2,1-2H3,(H,14,16).
What are the key properties of N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide has a molecular weight of 316.38 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-fluorophenyl)methyl]-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 60716086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).