2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid

C15H14N2O3 — CID 60716381

IUPAC2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid
SMILESO=C(O)c1ccnc(NC2CCOc3ccccc32)c1
InChIInChI=1S/C15H14N2O3/c18-15(19)10-5-7-16-14(9-10)17-12-6-8-20-13-4-2-1-3-11(12)13/h1-5,7,9,12H,6,8H2,(H,16,17)(H,18,19)
InChIKeyYYXJGKVIHNIXLW-UHFFFAOYSA-N
MW270.29 g/mol
LogP2.72
Rot. Bonds3

About 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid

2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid (PubChem CID 60716381) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid
PubChem CID60716381
Molecular FormulaC15H14N2O3
Molecular Weight270.29 g/mol
Exact Mass270.10
IUPAC Name2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid
SMILESO=C(O)c1ccnc(NC2CCOc3ccccc32)c1
InChIInChI=1S/C15H14N2O3/c18-15(19)10-5-7-16-14(9-10)17-12-6-8-20-13-4-2-1-3-11(12)13/h1-5,7,9,12H,6,8H2,(H,16,17)(H,18,19)
InChIKeyYYXJGKVIHNIXLW-UHFFFAOYSA-N
XLogP2.72
TPSA71.45 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.29
LogP ≤ 52.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid?
The IUPAC name of 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid (CID 60716381) is 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid.
What is the SMILES notation for 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid?
The canonical SMILES for 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid is O=C(O)c1ccnc(NC2CCOc3ccccc32)c1.
What is the InChIKey of 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid?
The InChIKey is YYXJGKVIHNIXLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3/c18-15(19)10-5-7-16-14(9-10)17-12-6-8-20-13-4-2-1-3-11(12)13/h1-5,7,9,12H,6,8H2,(H,16,17)(H,18,19).
What are the key properties of 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid?
2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid has a molecular weight of 270.29 g/mol, XLogP of 2.72, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-chromen-4-ylamino)pyridine-4-carboxylic acid is sourced from PubChem (CID 60716381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).