C13H13Cl2F3N2O — CID 60716732
3,6-dichloro-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 60716732) has the molecular formula C13H13Cl2F3N2O and a molecular weight of 341.16 g/mol. Its IUPAC name is 3,6-dichloro-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 60716732 |
| Molecular Formula | C13H13Cl2F3N2O |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 3,6-dichloro-N-(1-cyclopropylethyl)-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | CC(C1CC1)N(CC(F)(F)F)C(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H13Cl2F3N2O/c1-7(8-2-3-8)20(6-13(16,17)18)12(21)11-9(14)4-5-10(15)19-11/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | OISNHPDPSJTQGX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|