C13H21N3O3 — CID 60718057
ethyl 4-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]butanoate (PubChem CID 60718057) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is ethyl 4-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 60718057 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | ethyl 4-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)Cc1c(C)n[nH]c1C |
| InChI | InChI=1S/C13H21N3O3/c1-4-19-13(18)6-5-7-14-12(17)8-11-9(2)15-16-10(11)3/h4-8H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | TVPMLHRCXZWNRO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|