C16H26N2O2 — CID 60720089
N-pentyl-2-(2-phenoxyethylamino)propanamide (PubChem CID 60720089) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-pentyl-2-(2-phenoxyethylamino)propanamide.
| Compound Name | N-pentyl-2-(2-phenoxyethylamino)propanamide |
|---|---|
| PubChem CID | 60720089 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-pentyl-2-(2-phenoxyethylamino)propanamide |
| SMILES | CCCCCNC(=O)C(C)NCCOc1ccccc1 |
| InChI | InChI=1S/C16H26N2O2/c1-3-4-8-11-18-16(19)14(2)17-12-13-20-15-9-6-5-7-10-15/h5-7,9-10,14,17H,3-4,8,11-13H2,1-2H3,(H,18,19) |
| InChIKey | OGAQOZMNNPWOQB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|