C16H25FN2O — CID 60720096
2-[1-(3-fluorophenyl)ethylamino]-N-pentylpropanamide (PubChem CID 60720096) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[1-(3-fluorophenyl)ethylamino]-N-pentylpropanamide.
| Compound Name | 2-[1-(3-fluorophenyl)ethylamino]-N-pentylpropanamide |
|---|---|
| PubChem CID | 60720096 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-[1-(3-fluorophenyl)ethylamino]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)C(C)NC(C)c1cccc(F)c1 |
| InChI | InChI=1S/C16H25FN2O/c1-4-5-6-10-18-16(20)13(3)19-12(2)14-8-7-9-15(17)11-14/h7-9,11-13,19H,4-6,10H2,1-3H3,(H,18,20) |
| InChIKey | MAMJZRVCNQBNEY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|